A5076612
Isoguanine , >97.0%(HPLC) , 3373-53-3
CAS NO.:3373-53-3
Empirical Formula: C5H5N5O
Molecular Weight: 151.13
MDL number: MFCD00142931
EINECS: 222-157-6
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB47.20 | In Stock |
|
| 50mg | RMB199.20 | In Stock |
|
| 100MG | RMB314.40 | In Stock |
|
| 250mg | RMB618.40 | In Stock |
|
| 1g | RMB1553.60 | In Stock |
|
| 5g | RMB5192.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 273.11°C (rough estimate) |
| Density | 1.4456 (rough estimate) |
| refractive index | 1.8000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Base (Slightly) |
| form | Powder |
| pka | 5.32±0.40(Predicted) |
| color | Off-white to slightly beige |
| Water Solubility | SLIGHTLY SOLUBLE |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H5N5O/c6-3-2-4(8-1-7-2)10-5(11)9-3/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | DRAVOWXCEBXPTN-UHFFFAOYSA-N |
| SMILES | N1C2=C(NC(=O)N=C2N)N=C1 |
| CAS DataBase Reference | 3373-53-3(CAS DataBase Reference) |
Description and Uses
A nucleotide base as immunostimulator agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29335995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






