A5081812
Isosorbide Dimethyl Ether , >98.0%(GC) , 5306-85-4
Synonym(s):
DMI;Dimethyl isosorbide;Isosorbide dimethyl ether;1,4:3,6-Dianhydro-2,5-di-O-methyl-D -glucitol;1,4:3,6-Dianhydrosorbitol 2,5-dimethyl ether
CAS NO.:5306-85-4
Empirical Formula: C8H14O4
Molecular Weight: 174.2
MDL number: MFCD00064828
EINECS: 226-159-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 10g | RMB28.00 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB100.80 | In Stock |
|
| 500g | RMB377.60 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -70°C |
| Boiling point: | 93-95 °C0.1 mm Hg(lit.) |
| Density | 1.15 g/mL at 25 °C(lit.) |
| vapor pressure | 12.54Pa at 20℃ |
| refractive index | n |
| Flash point: | 227 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to light yellow |
| PH | 7.0-8.0 (100g/l, H2O, 20℃) |
| optical activity | [α]21/D +96.1°, c = 2 in chloroform |
| Water Solubility | Soluble in water. |
| BRN | 80854 |
| Cosmetics Ingredients Functions | SOLVENT VISCOSITY CONTROLLING |
| InChI | 1S/C8H14O4/c1-9-5-3-11-8-6(10-2)4-12-7(5)8/h5-8H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | MEJYDZQQVZJMPP-ULAWRXDQSA-N |
| SMILES | CO[C@H]1COC2[C@@H](COC12)OC |
| LogP | -1.62 |
| CAS DataBase Reference | 5306-85-4(CAS DataBase Reference) |
Description and Uses
dimethyl isosorbide is a carrier, solvent, and viscosity controller. Its particular skin-penetrating ability opens the possibility of enhancing active substance efficacy in optical products. Its physical characteristics and solubility properties are superior to those of propylene glycol, glycerin, or ethyl alcohol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29092000 |
| Storage Class | 10 - Combustible liquids |
| REACH Registrations | Active |





