BD0386953
Cyclohexane-1,2,3,4,5,6-hexaol , 98% , 6917-35-7
CAS NO.：6917-35-7
Empirical Formula: C6H12O6
Molecular Weight: 180.16
MDL number: MFCD00077932
EINECS: 230-024-9
| Pack Size | Price | Stock | Quantity |
| 10g | RMB48.00 | In Stock |
|
| 25g | RMB88.00 | In Stock |
|
| 100g | RMB240.00 | In Stock |
|
| 500g | RMB888.80 | In Stock |
|
| 1000g | RMB1333.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252 °C |
| Boiling point: | 291.3±40.0 °C(Predicted) |
| Density | 2.038±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 12.63±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H |
| InChIKey | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| SMILES | OC1C(O)C(O)C(O)C(O)C1O |
| EPA Substance Registry System | Inositol (6917-35-7) |
Description and Uses
Inositol is an essentially non toxic compound largely formed by the dephosphorylation of inositol hexaphosphate (IP6, Phytate) with in the gastrointestinal tract in humans and animals.
