A5087212
2-Isonitrosopropiophenone , >98.0%(GC) , 119-51-7
Synonym(s):
1-Phenyl-1,2-propanedione-2-oxime;2-(Hydroxyimino)propiophenone;NSC 5410
CAS NO.:119-51-7
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD00002115
EINECS: 204-329-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB342.40 | In Stock |
|
| 100G | RMB778.40 | In Stock |
|
| 500G | RMB4479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C(lit.) |
| Boiling point: | 290.25°C (rough estimate) |
| Density | 1.2021 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | 9.28±0.10(Predicted) |
| form | Crystals |
| color | White to light yellow |
| λmax | 398nm(MeOH)(lit.) |
| InChI | InChI=1S/C9H9NO2/c1-7(10-12)9(11)8-5-3-2-4-6-8/h2-6,12H,1H3 |
| InChIKey | YPINLRNGSGGJJT-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C(=NO)C |
| CAS DataBase Reference | 119-51-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Phenyl-1,2-propane-dione-2-oxime(119-51-7) |
| EPA Substance Registry System | 1,2-Propanedione, 1-phenyl-, 2-oxime (119-51-7) |
Description and Uses
Reactant involved in synthesis of:
- Cyclometalated iridium complexes for photophysical and electrochemical studies
- Hydroimidazothiazoles via iodination and cyclization reactions
Reactant involved in:
- Sonogashira coupling reactions
- Allylation of aromatic aldehydes using imidazole oside catalysts
- Beckmann rearrangement of α-oximinoketones
Reagent used in the colorimetric determination of urea
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H317-H400-H411 |
| Precautionary statements | P280-P302+P352-P304+P340 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| WGK Germany | 2 |
| RTECS | UH2975000 |
| TSCA | TSCA listed |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |






