A5093212
Isophthalic Dihydrazide , >95.0%(HPLC)(T) , 2760-98-7
CAS NO.:2760-98-7
Empirical Formula: C8H10N4O2
Molecular Weight: 194.19
MDL number: MFCD00025117
EINECS: 220-425-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB19.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB80.00 | In Stock |
|
| 500G | RMB234.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 224°C |
| Density | 1.344±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pka | 11.87±0.10(Predicted) |
| form | Solid:particulate/powder |
| color | White to Almost white |
| InChI | InChI=1S/C8H10N4O2/c9-11-7(13)5-2-1-3-6(4-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | UTTHLMXOSUFZCQ-UHFFFAOYSA-N |
| SMILES | C(NN)(C1C=C(C=CC=1)C(NN)=O)=O |
| LogP | -1.4 at 20℃ and pH7.1 |
| Surface tension | 74.4mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 2760-98-7(CAS DataBase Reference) |
| EPA Substance Registry System | Isophthalic acid dihydrazide (2760-98-7) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 29280000 |
| REACH Registrations | Active |





