A6633212
Phthalhydrazide , 99% , 1445-69-8
Synonym(s):
2,3-Dihydro-1,4-phthalazinedione
CAS NO.：1445-69-8
Empirical Formula: C8H6N2O2
Molecular Weight: 162.15
MDL number: MFCD00006888
EINECS: 215-893-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.00 | In Stock |
|
| 100G | RMB108.00 | In Stock |
|
| 500G | RMB316.00 | In Stock |
|
| 2.5kg | RMB1307.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in acetone and acetic acid. |
| form | Powder and Chunks |
| pka | 10.70±0.20(Predicted) |
| color | White |
| BRN | 135926 |
| InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | KGLPWQKSKUVKMJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)NN1 |
| CAS DataBase Reference | 1445-69-8(CAS DataBase Reference) |
Description and Uses
Phthalic Hydrazide is a reagent in the synthesis in various pyrazolophthalazine derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | TH8890080 |
| HS Code | 29280000 |
| Toxicity | mouse,LD50,intraperitoneal,700mg/kg (700mg/kg),Archiv der Pharmazie Vol. 327, Pg. 237, 1994. |
