A5094912
Isorhapontigenin , >96.0%(HPLC) , 32507-66-7
Synonym(s):
(E)- 3′-methoxy-3,4′,5-stilbenetriol;(E)-5-[2-(4-Hydroxy-3-methoxyphenyl)ethenyl]-1,3-benzenediol;3′-Methoxyresveratrol;Isorhapotigenin;Isorhapotogenin
CAS NO.:32507-66-7
Empirical Formula: C15H14O4
Molecular Weight: 258.27
MDL number: MFCD12407151
EINECS: 803-480-7
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB207.20 | In Stock |
|
| 50mg | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180.0 to 184.0 °C |
| Boiling point: | 471.8±35.0 °C(Predicted) |
| Density | 1.345 |
| storage temp. | room temp |
| solubility | DMSO: soluble15mg/mL, clear |
| form | powder |
| pka | 9.16±0.10(Predicted) |
| color | white to light brown |
| InChI | InChI=1S/C15H14O4/c1-19-15-8-10(4-5-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+ |
| InChIKey | ANNNBEZJTNCXHY-NSCUHMNNSA-N |
| SMILES | C1(O)=CC(/C=C/C2=CC=C(O)C(OC)=C2)=CC(O)=C1 |
Description and Uses
Isorhapontigenin, an orally bioavailable dietary polyphenol isolated from the Chinese herb Gnetum cleistostachyum, displays anti-inflammatory effects. Isorhapontigenin induces autophagy and inhibits invasive bladder cancer formation[1][2].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-43-51 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2909.50.5000 |






