A5096812
Isopropyl 3-Aminocrotonate , 96% , 14205-46-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 10g | RMB39.20 | In Stock |
|
| 25g | RMB55.20 | In Stock |
|
| 100g | RMB100.00 | In Stock |
|
| 500g | RMB356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 19-23°C |
| Boiling point: | 80°C/1mmHg(lit.) |
| Density | 0.987±0.06 g/cm3(Predicted) |
| refractive index | 1.4870 to 1.4910 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Colourless Liquid |
| pka | 5.36±0.70(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H13NO2/c1-5(2)10-7(9)4-6(3)8/h4-5H,8H2,1-3H3 |
| InChIKey | YCKAGGHNUHZKCL-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)C=C(N)C |
| CAS DataBase Reference | 14205-46-0(CAS DataBase Reference) |
Description and Uses
Isopropyl 3-Aminocrotonate (cas# 14205-46-0) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| RTECS | EM9095000 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
