BD0064148
4-Methyl-2,1,3-benzoxadiazole , 98% , 29091-40-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB311.20 | In Stock |
|
| 1g | RMB710.40 | In Stock |
|
| 5g | RMB2057.60 | In Stock |
|
| 10g | RMB3669.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 209.2℃ |
| Density | 1.229 |
| Flash point: | 82.0℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder or Lms |
| pka | -0.60±0.45(Predicted) |
| color | Pale yellow to yellow |
| InChI | InChI=1S/C7H6N2O/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3 |
| InChIKey | PTXJEYIAUIOTSH-UHFFFAOYSA-N |
| SMILES | N1=C2C=CC=C(C)C2=NO1 |
Description and Uses
4-Methyl-2,1,3-benzoxadiazole is a useful reactant for the synthesis of benzochalcogenodiazole for the use as organic solar cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340+P312-P305+P351+P338-P337+P313 |
| HS Code | 2934999090 |
