A5114612
(<I>S</I>)-(−)-1-Boc-2-<I>tert</I>-butyl-3-methyl-4-imidazolidinone , 98% , 119838-38-9
Synonym(s):
(S)-(−)-1-(tert-Butoxycarbonyl)-2-tert-butyl-3-methyl-4-imidazolidinone
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB127.20 | In Stock |
|
| 250MG | RMB389.60 | In Stock |
|
| 1G | RMB1128.80 | In Stock |
|
| 5g | RMB5919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-69 °C(lit.) |
| Boiling point: | 355.3±35.0 °C(Predicted) |
| Density | 1.064±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -0.60±0.40(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]25/D 14°, c = 1 in methylene chloride |
| BRN | 4907144 |
| InChI | InChI=1S/C13H24N2O3/c1-12(2,3)10-14(7)9(16)8-15(10)11(17)18-13(4,5)6/h10H,8H2,1-7H3/t10-/m0/s1 |
| InChIKey | HJJLVATZPPJBNG-JTQLQIEISA-N |
| SMILES | [C@@H]1(C(C)(C)C)N(C(OC(C)(C)C)=O)CC(=O)N1C |
Description and Uses
(2S)-2-(1,1-Dimethylethyl)-3-methyl-4-oxo-1-imidazolidinecarboxylic Acid 1,1-Dimethylethyl Ester is a glycine derivative that is used as starting material for the preparation of open-chain amino acids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8-10 |






