A5128712
IB-MECA , 98%(HPLC) , 152918-18-8
Synonym(s):
1-Deoxy-1-[6-[((3-Iodophenyl)methyl)amino]-9H-purin-9-yl]-N-methyl-β-D -ribofuranuronamide;N6-(3-Iodobenzyl)adenosine-5′-N-methyluronamide
CAS NO.:152918-18-8
Empirical Formula: C18H19IN6O4
Molecular Weight: 510.29
MDL number: MFCD00671785
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB719.20 | In Stock |
|
| 10mg | RMB1279.20 | In Stock |
|
| 25MG | RMB2879.20 | In Stock |
|
| 50mg | RMB5183.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | hot ethanol: >10 mg/mL |
| pka | 12.72±0.70(Predicted) |
| form | solid |
| color | white |
| InChIKey | HUJXGQILHAUCCV-MOROJQBDSA-N |
| SMILES | CNC(=O)[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(NCc4cccc(I)c4)ncnc23 |
Description and Uses
IB-MECA has been used for intraocular pressure and corneal thickness measurements in rabbits.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






