A5132212
(4<I>S</I>,5<I>R</I>)-(−)-4-Methyl-5-phenyl-2-oxazolidinone , 97% , 16251-45-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB169.60 | In Stock |
|
| 25g | RMB753.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-123 °C(lit.) |
| Boiling point: | 309.12°C (rough estimate) |
| Density | 1.1607 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 12.35±0.60(Predicted) |
| color | Off-white |
| optical activity | [α]25/D 168°, c = 2 in chloroform |
| InChI | InChI=1S/C10H11NO2/c1-7-9(13-10(12)11-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | PPIBJOQGAJBQDF-CBAPKCEASA-N |
| SMILES | O1[C@H](C2=CC=CC=C2)[C@H](C)NC1=O |
| CAS DataBase Reference | 16251-45-9(CAS DataBase Reference) |
Description and Uses
(4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone may be used to synthesize (4S,5R)-N-tert-butyloxycarbonyl)-4-methyl-5-carboxy-2-oxazolidinone and (+)-pumiliotoxin B.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H412 |
| Precautionary statements | P261-P273-P305+P351+P338 |
| Safety Statements | 24/25-25-24 |
| WGK Germany | 3 |
| HS Code | 29269090 |






![1,1-DIPHENYL-TETRAHYDRO-PYRROLO[1,2-C]OXAZOL-3-ONE](https://img.chemicalbook.com/CAS/GIF/160424-29-3.gif)