A5141112
<I>N</I>-<WBR>(2-<WBR>(Methylsulfonyl)<WBR>phenyl)<WBR>acetamide , 97% , 20628-27-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB639.20 | In Stock |
|
| 25g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143.5-147.5 °C(lit.) |
| Boiling point: | 478.5±37.0 °C(Predicted) |
| Density | 1.297±0.06 g/cm3(Predicted) |
| pka | 13.99±0.70(Predicted) |
| form | crystalline solid |
| color | Faint to light brown |
| InChI | 1S/C9H11NO3S/c1-7(11)10-8-5-3-4-6-9(8)14(2,12)13/h3-6H,1-2H3,(H,10,11) |
| InChIKey | NGWCPCSZLLJKPD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccccc1S(C)(=O)=O |
Description and Uses
N-Acetyl-2-(methylsulphonyl)aniline is an intermediate for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2930909899 |
| Storage Class | 13 - Non Combustible Solids |
