A5151912
(1<I>S</I>,2<I>S</I>)<WBR>-<WBR>(+)<WBR>-<WBR>2-<WBR>Amino-<WBR>1-<WBR>(4-<WBR>nitrophenyl)<WBR>-<WBR>1,3-<WBR>propanediol , 99% , 2964-48-9
CAS NO.:2964-48-9
Empirical Formula: C9H12N2O4
Molecular Weight: 212.2
MDL number: MFCD00007359
EINECS: 221-001-4
| Pack Size | Price | Stock | Quantity |
| 10G | RMB36.80 | In Stock |
|
| 50G | RMB111.20 | In Stock |
|
| 25g | RMB184.00 | In Stock |
|
| 100g | RMB438.40 | In Stock |
|
| 500g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C(lit.) |
| Boiling point: | 352.03°C (rough estimate) |
| alpha | 31 º (C=1 IN 6 M HCL) |
| Density | 1.3136 (rough estimate) |
| refractive index | 1.5373 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in DMSO, Methanol |
| form | Crystalline Powder |
| pka | 10.98±0.45(Predicted) |
| color | Yellow to beige |
| optical activity | [α]23/D +31°, c = 1 in 6 M HCl |
| InChI | InChI=1S/C9H12N2O4/c10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h1-4,8-9,12-13H,5,10H2/t8-,9-/m0/s1 |
| InChIKey | OCYJXSUPZMNXEN-IUCAKERBSA-N |
| SMILES | [C@@H](C1=CC=C([N+]([O-])=O)C=C1)(O)[C@@H](N)CO |
Description and Uses
(1S,2S)-2-Amino-1-(4-nitrophenyl)propane-1,3-diol can be used in the synthesis of (4S,5S)-(-)-isocytoxazone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |




