![<I>trans</I>-<WBR>2-<WBR>[4-<WBR>(Trifluoromethyl)<WBR>phenyl]<WBR>vinylboronic acid](https://img.chemicalbook.com/CAS/GIF/352525-91-8.gif)
A5157712
<I>trans</I>-<WBR>2-<WBR>[4-<WBR>(Trifluoromethyl)<WBR>phenyl]<WBR>vinylboronic acid , 95% , 352525-91-8
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB95.20 | In Stock |
|
| 250mg | RMB319.20 | In Stock |
|
| 1G | RMB799.20 | In Stock |
|
| 5G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-210 °C(lit.) |
| form | solid |
| InChI | 1S/C9H8BF3O2/c11-9(12,13)8-3-1-7(2-4-8)5-6-10(14)15/h1-6,14-15H/b6-5+ |
| InChIKey | BBNQFBHQOPZKTI-AATRIKPKSA-N |
| SMILES | [H]\C(B(O)O)=C(\[H])c1ccc(cc1)C(F)(F)F |
Description and Uses
trans-2-[4-(Trifluoromethyl)phenyl]vinylboronic Acid is used in preparation of novel chromane, isochromane, thiochromane, or tetrahydroquinoline derivatives as glucosylceramide synthase (GCS) inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
