A5160012
                    <I>N</I><SUP>10</SUP>-<WBR>(Trifluoroacetyl)<WBR>pteroic acid , 95% , 37793-53-6
CAS NO.:37793-53-6
Empirical Formula: C16H11F3N6O4
Molecular Weight: 408.29
MDL number: MFCD00006707
| Pack Size | Price | Stock | Quantity | 
| 25MG | RMB559.20 | In Stock | 
                                                 | 
                                        
| 100mg | RMB1599.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 270 °C (dec.)(lit.) | 
                                    
| Boiling point: | 575.0±60.0 °C(Predicted) | 
                                    
| Density | 1.74±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
                                    
| solubility | DMF (Slightly), DMSO (Slightly) | 
                                    
| pka | 4.11±0.10(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Brown to Dark Brown | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChI | InChI=1S/C16H11F3N6O4/c17-16(18,19)14(29)25(9-3-1-7(2-4-9)13(27)28)6-8-5-21-11-10(22-8)12(26)24-15(20)23-11/h1-5H,6H2,(H,27,28)(H3,20,21,23,24,26) | 
                                    
| InChIKey | IJGIHDXKYQLIMA-UHFFFAOYSA-N | 
                                    
| SMILES | C(O)(=O)C1=CC=C(N(CC2=CN=C3C(=N2)C(=O)NC(N)=N3)C(C(F)(F)F)=O)C=C1 | 
                                    
Description and Uses
N10-Trifluoroacetylpteroic acid is a derivative of Pteroic acid (P840110), both of which are used as reagents to synthesize target ligands, like Folic acid (F680300), that have the ability to deliver chemotherapeutic agents specifically to cancer cells.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08  | 
                                    
| Signal word | Danger | 
| Hazard statements | H302+H312+H332-H315-H319-H335-H350 | 
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 | 
| Hazard Codes | T | 
| Risk Statements | 45-20/21/22-36/37/38 | 
| Safety Statements | 53-22-26-36/37/39-45 | 
| RIDADR | UN 2811 6.1/PG 3 | 
| WGK Germany | 3 | 
| HS Code | 29339900 | 







