A5168012
                    <I>N</I>-Boc-4-hydroxyaniline , 97% , 54840-15-2
                            Synonym(s):
N-Boc-4-aminophenol
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 1g | RMB28.00 | In Stock | 
                                                 | 
                                        
| 5G | RMB60.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB287.20 | In Stock | 
                                                 | 
                                        
| 100g | RMB1039.20 | In Stock | 
                                                 | 
                                        
| 500g | RMB4479.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 143-147 °C(lit.) | 
                                    
| Boiling point: | 288.7±23.0 °C(Predicted) | 
                                    
| Density | 1.182±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| pka | 10.13±0.26(Predicted) | 
                                    
| Appearance | White to off-white Solid | 
                                    
| Water Solubility | Slightly soluble in water. | 
                                    
| InChI | InChI=1S/C11H15NO3/c1-11(2,3)15-10(14)12-8-4-6-9(13)7-5-8/h4-7,13H,1-3H3,(H,12,14) | 
                                    
| InChIKey | YRQMBQUMJFVZLF-UHFFFAOYSA-N | 
                                    
| SMILES | C(OC(C)(C)C)(=O)NC1=CC=C(O)C=C1 | 
                                    
| CAS DataBase Reference | 54840-15-2(CAS DataBase Reference) | 
                                    
Description and Uses
4-(Boc-amino)phenol, is used to protect amine in the solid phase synthesis of peptides, used to produce [4-(tert-butyl-dimethyl-silanyloxy)-phenyl]-carbamic acid tert-butyl ester at ambient temperature. This reaction will need reagent imidazole and solvent dimethylformamide, CH2Cl2.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38-43 | 
| Safety Statements | 26-36-36/37 | 
| WGK Germany | 3 | 
| HazardClass | IRRITANT | 





![Benzoicacid,2-[[(1,1-dimethylethoxy)carbonyl]amino]-5-methoxy-(9CI)](https://img.chemicalbook.com/CAS/GIF/262614-64-2.gif)
