PRODUCT Properties
| Melting point: | 298 °C (dec.)(lit.) |
| Boiling point: | 400.49°C (rough estimate) |
| Density | 1.2471 (rough estimate) |
| refractive index | 1.5780 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.36±0.36(Predicted) |
| Appearance | Light yellow to khaki Solid |
| Merck | 13,3350 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H11NO4/c16-13(17)9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(18)19/h1-8,15H,(H,16,17)(H,18,19) |
| InChIKey | ZFRNOTZQUGWMQN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1Nc2ccccc2C(O)=O |
Description and Uses
Instead of diphenylamine in reactions with oxidizing agents. 2,2'-iminodibenzoic acid may be used as an oxidation-reduction indicator in strongly acid solutions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DH2960000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
