A5196812
Indole-3-butyric acid potassium salt , 95% , 60096-23-3
Synonym(s):
4-(3-Indolyl)butanoic acid;IBA
CAS NO.:60096-23-3
Empirical Formula: C12H12KNO2
Molecular Weight: 241.33
MDL number: MFCD00058442
EINECS: 691-783-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB30.40 | In Stock |
|
| 10g | RMB74.40 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100g | RMB237.60 | In Stock |
|
| 500g | RMB1023.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >270°C (dec.) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Off-White to Pale Orange |
| Stability: | Hygroscopic |
| Major Application | agriculture |
| InChI | InChI=1S/C12H13NO2.K.H/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;;/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);; |
| InChIKey | KTWDHJYSJOSTSJ-UHFFFAOYSA-M |
| SMILES | C(C1=CNC2=CC=CC=C12)CCC(=O)O.[KH] |
| CAS DataBase Reference | 60096-23-3(CAS DataBase Reference) |
Description and Uses
Indole-3-butyric Acid Potassium Salt is being studied as a new precursor for the preparation of nitrogen-rich carbons via one-step carbonization used for CO2 adsorption.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |




