A5208912
4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole , 95% , 201166-22-5
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB196.80 | In Stock |
|
| 100MG | RMB559.20 | In Stock |
|
| 500MG | RMB1519.20 | In Stock |
|
| 1g | RMB2879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 240.5±35.0 °C(Predicted) |
| Density | 1.016±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C12H16O2/c1-8(2)9-6-5-7-10-11(9)14-12(3,4)13-10/h5-8H,1-4H3 |
| InChIKey | DHDJXCHGRUOYCV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(OC(C)(C)O2)=CC=C1 |
Description and Uses
2,2-Dimethyl-4-isopropyl-1,3-benzodioxole (Propofol EP Impurity L).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |

![4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole](https://img.chemicalbook.com/CAS/GIF/201166-22-5.gif)






