PRODUCT Properties
| Boiling point: | 130-131 °C(Press: 4-5 Torr) |
| Density | 1.032±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | liquid |
| Appearance | Light yellow to brown Liquid |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C12H16O2/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14/h5-8H,1-4H3 |
| InChIKey | DDXYWFGBQZICBD-UHFFFAOYSA-N |
| SMILES | O=C1C(=CC(=O)C=C1C(C)C)C(C)C |
Description and Uses
Propofol (P829750) impurity.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |





![4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole](https://img.chemicalbook.com/CAS/GIF/201166-22-5.gif)
