A5209512
Isopropyl 4-methylbenzenesulfonate , 95% , 2307-69-9
Synonym(s):
Isopropyl p-tosylate
CAS NO.：2307-69-9
Empirical Formula: C10H14O3S
Molecular Weight: 214.28
MDL number: MFCD00968877
EINECS: 218-989-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 25g | RMB230.40 | In Stock |
|
| 100g | RMB790.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20 |
| Boiling point: | 107-109 °C(Press: 0.4 Torr) |
| Density | 1.142 g/mL at 25 °C |
| refractive index | n20/D1.503 |
| Flash point: | 110 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| InChI | InChI=1S/C10H14O3S/c1-8(2)13-14(11,12)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
| InChIKey | SDQCGKJCBWXRMK-UHFFFAOYSA-N |
| SMILES | C1(S(OC(C)C)(=O)=O)=CC=C(C)C=C1 |
Description and Uses
Isopropyl p-Tosylate is a sulfonic acid ester, a potentialy alkylating agent. Studies suggest Isopropyl p-Tosylate may exert genotoxic effects in bacterial and mammalian cell systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29041000 |
