A5245012
                    Kaempferol 3-β-<SC>D</SC>-glucopyranoside , 97.0%(HPLC) , 480-10-4
                            Synonym(s):
Astragalin;DDD;Kaempferol 3-glucoside;KRT5;KRT5A
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 5MG | RMB455.20 | In Stock | 
                                                 | 
                                        
| 25MG | RMB1119.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 223-229°C | 
                                    
| Boiling point: | 823.2±65.0 °C(Predicted) | 
                                    
| Density | 1.79±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
                                    
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:6): 0.14 mg/ml | 
                                    
| pka | 6.20±0.40(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Yellow | 
                                    
| biological source | mouse | 
                                    
| InChIKey | JPUKWEQWGBDDQB-QSOFNFLRSA-N | 
                                    
| SMILES | O=C1C(=C(C2C=CC(O)=CC=2)OC2=CC(O)=CC(O)=C12)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O |&1:21,22,23,25,27,r| | 
                                    
| LogP | 1.950 (est) | 
                                    
| CAS DataBase Reference | 480-10-4(CAS DataBase Reference) | 
                                    
Description and Uses
Astragaline is found in Erica multiflora leaf extract, which is used for mitigating high-?fat and high-?fructose diet (HFFD)?-?induced metabolic syndrome.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | 
| Safety Statements | 22 | 
| WGK Germany | 3 | 
| RTECS | DJ3080000 | 
| HS Code | 29389090 | 







