BD9497331
Jaceosidin , 99+% , 18085-97-7
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-260 °C |
| Boiling point: | 619.0±55.0 °C(Predicted) |
| Density | 1.483±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated), Pyridine (Slightly) |
| form | Solid |
| pka | 6.47±0.40(Predicted) |
| color | Pale Yellow to Light Yellow |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3 |
| InChIKey | GLAAQZFBFGEBPS-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C(OC)=C2)OC2=CC(O)=C(OC)C(O)=C2C(=O)C=1 |
| LogP | 1.300 (est) |
Description and Uses
Jaceosidin exhibits anti-allergic, anti-inflammatory and apoptosis inducing activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |





