A5246912
L-Lysine ethyl ester dihydrochloride , 98% , 3844-53-9
CAS NO.:3844-53-9
Empirical Formula: C8H20Cl2N2O2
Molecular Weight: 247.16
MDL number: MFCD00039068
EINECS: 223-340-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB28.80 | In Stock |
|
| 25G | RMB120.00 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| 500g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~150 °C (dec.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly, Heated), Water (Sparingly) |
| form | Solid |
| color | Off-White |
| optical activity | [α]20/D +10±1°, c = 2% in H2O |
| Sensitive | Hygroscopic |
| BRN | 3697099 |
| Major Application | peptide synthesis |
| InChI | 1S/C8H18N2O2.2ClH/c1-2-12-8(11)7(10)5-3-4-6-9;;/h7H,2-6,9-10H2,1H3;2*1H/t7-;;/m0../s1 |
| InChIKey | DZIYAIZKJOHVQC-KLXURFKVSA-N |
| SMILES | Cl.Cl.CCOC(=O)[C@@H](N)CCCCN |
| CAS DataBase Reference | 3844-53-9(CAS DataBase Reference) |
Description and Uses
L-Lysine Ethyl Ester Dihydrochloride is a reagent used in the preparation of myxochelin which has been shown to possess strong anti-tumor activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |






