A7759812
Nε-Trifluoroacetyl-L-lysine , 97% , 10009-20-8
Synonym(s):
ε-TFA-lysine
CAS NO.:10009-20-8
Empirical Formula: C8H13F3N2O3
Molecular Weight: 242.2
MDL number: MFCD00037223
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB108.00 | In Stock |
|
| 100g | RMB327.20 | In Stock |
|
| 500g | RMB1078.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258 |
| Boiling point: | 382.5±42.0 °C(Predicted) |
| Density | 1.4 |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | 2 M HCl: 10 mg/mL, clear, colorless |
| pka | 2.51±0.24(Predicted) |
| form | Solid |
| color | Off-White |
| BRN | 2122429 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H13F3N2O3/c9-8(10,11)7(16)13-4-2-1-3-5(12)6(14)15/h5H,1-4,12H2,(H,13,16)(H,14,15)/t5-/m0/s1 |
| InChIKey | PZZHRSVBHRVIMI-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(C(F)(F)F)=O)N |
Description and Uses
A cysteine conjugate metabolite adduct formation with specific mitochondrial proteins using antibodies raised against halothane metabolite adducts.







