A5277112
H-Lys(Z)-OBzl hydrochloride , 99% , 6366-70-7
CAS NO.：6366-70-7
Empirical Formula: C21H27ClN2O4
Molecular Weight: 406.9
MDL number: MFCD00038981
EINECS: 228-859-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100g | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO, DMF, Methanol |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D 6.5±1°, c = 0.5% in 0.1 M HCl |
| BRN | 3580519 |
| InChI | InChI=1/C21H26N2O4.ClH/c22-19(20(24)26-15-17-9-3-1-4-10-17)13-7-8-14-23-21(25)27-16-18-11-5-2-6-12-18;/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,25);1H/t19-;/s3 |
| InChIKey | XHBTZNKKLKICJY-FYZYNONXSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)[C@H](CCCCNC(OCC1C=CC=CC=1)=O)N.[H]Cl |&1:10,r| |
| CAS DataBase Reference | 6366-70-7(CAS DataBase Reference) |
Description and Uses
N6-Cbz-L-Lysine benzyl ester hydrochloride can be useful for the preparation of pseudopeptides as thrombolytic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| WGK Germany | 3 |
| RTECS | OL5685000 |
| HS Code | 2922500090 |
