A5257112
Nε-Carbobenzoxy-L-lysine , 98% , 1155-64-2
Synonym(s):
Nε-Z-L -lysine;N6-Carbobenzyloxy-L -lysine
CAS NO.:1155-64-2
Empirical Formula: C14H20N2O4
Molecular Weight: 280.32
MDL number: MFCD00002638
EINECS: 214-585-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB234.40 | In Stock |
|
| 500g | RMB1000.80 | In Stock |
|
| 1kg | RMB1881.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259 °C (dec.)(lit.) |
| Boiling point: | 423.04°C (rough estimate) |
| alpha | 14.4 º (c=1.6 in 1N HCl) |
| Density | 1.1429 (rough estimate) |
| refractive index | 16 ° (C=1.6, 2mol/L HCl) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Base, Dilute Acid |
| pka | 2.53±0.24(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | [α]20/D +15.5±1°, c = 1% in 1 M HCl |
| BRN | 2222482 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | CKGCFBNYQJDIGS-LBPRGKRZSA-N |
| SMILES | C(O)(=O)[C@H](CCCCNC(OCC1=CC=CC=C1)=O)N |
| CAS DataBase Reference | 1155-64-2(CAS DataBase Reference) |
Description and Uses
Protected amino acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







