2-amino-6-benzyloxycarbonylamino-hexanoic acid tert-bu ester,hydrochloride , ≥97% , 5978-22-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 250mg | RMB26.40 | In Stock |
|
| 5g | RMB79.20 | In Stock |
|
| 25g | RMB295.20 | In Stock |
|
| 100g | RMB1148.80 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 144 - 145°C |
| Flash point: | 237.8℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C18H28N2O4.ClH/c1-18(2,3)24-16(21)15(19)11-7-8-12-20-17(22)23-13-14-9-5-4-6-10-14;/h4-6,9-10,15H,7-8,11-13,19H2,1-3H3,(H,20,22);1H/t15-;/s3 |
| InChIKey | HEMZMPXAQORYDR-AVAJOTNLNA-N |
| SMILES | C(C1C=CC=CC=1)OC(=O)NCCCC[C@H](N)C(=O)OC(C)(C)C.Cl |&1:15,r| |
| CAS DataBase Reference | 5978-22-3(CAS DataBase Reference) |
Description and Uses
H-Lys(Z)-OtBu.HCl, a lysine derivative, serves as a synthetic organic compound extensively utilized in scientific research. H-Lys(Z)-OtBu.HCl represents the hydrochloride salt of the tert-butyl ester of 6-aminohexanoic acid. The tert-butyl ester of 6-aminohexanoic acid acts as a carboxylic acid, serving as a valuable tool in peptide synthesis for the production of peptide amides, peptide esters, and other peptide derivatives. Furthermore, the hydrochloride salt of the tert-butyl ester of 6-aminohexanoic acid assumes a crucial role as a building block in organic synthesis, enabling the creation of diverse organic compounds, such as tri-tert-butyl (9S,13S)-3,11-dioxo-1-phenyl-2-oxa-4,10,12-triazapentadecane-9,13,15-tricarboxylate.
H-Lys(z)-OtBu Hydrochloride is an inhibitor of dihydrofolate reductase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 29242990 |







