A5264012
Lissamine rhodamine B , 85% , 3520-42-1
Synonym(s):
Acid Red 52;Kiton Red 620;Sulforhodamine B monosodium salt
CAS NO.:3520-42-1
Empirical Formula: C27H29N2NaO7S2
Molecular Weight: 580.65
MDL number: MFCD00010180
EINECS: 222-529-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100g | RMB448.80 | In Stock |
|
| 500g | RMB1772.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.472[at 20℃] |
| storage temp. | room temp |
| solubility | methanol: 1 mg/mL |
| form | powder |
| Colour Index | 45100 |
| color | Brown to Very Dark Purple |
| biological source | synthetic (organic) |
| Water Solubility | 95.3g/L at 20℃ |
| ε(extinction coefficient) | ≥85000 at 554-560nm in 0.1 M NaOH in methanol at 0.005g/L |
| λmax | 554 nm |
| BRN | 3886008 |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChIKey | XCRMYPBRGZRYEU-UHFFFAOYSA-N |
| SMILES | S(C1C=C(S(O)(=O)=O)C=CC=1C1C2=CC=C(N(CC)CC)C=C2[O+]=C2C=C(N(CC)CC)C=CC=12)([O-])(=O)=O.[NaH] |
| LogP | -2.2 at 20℃ |
| EPA Substance Registry System | C.I. Acid Red 52 (3520-42-1) |
Description and Uses
Sulforhodamine B is a membrane-impermeant polar tracer.
Sulforhodamine B sodium salt has been used:
- for relative total cell mass quantification
- to investigate the viscosity of coacervates
- as a molecular rotor for microviscosity determination in aerosol droplets
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26-36/37/39 |
| WGK Germany | 2 |
| RTECS | BP6750000 |
| F | 8 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 11 - Combustible Solids |






