A5267512
H-Lys(Boc)-OH , 97% , 2418-95-3
Synonym(s):
Nε-Boc-L -lysine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB329.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C (dec.)(lit.) |
| alpha | 17 º (c=1% in acetic acid) |
| Boiling point: | 389.3°C (rough estimate) |
| Density | 1.1313 (rough estimate) |
| refractive index | 18 ° (C=1, AcOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 2.53±0.24(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +18°, c = 1 in acetic acid |
| Water Solubility | Slightly soluble in water. |
| BRN | 2417626 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H22N2O4/c1-11(2,3)17-10(16)13-7-5-4-6-8(12)9(14)15/h8H,4-7,12H2,1-3H3,(H,13,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | VVQIIIAZJXTLRE-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(O)=O |
| CAS DataBase Reference | 2418-95-3(CAS DataBase Reference) |
Description and Uses
It is used as therapy to treat recurrent herpes simplex infections.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |






