A5272612
Levamisol hydrochloride , Analysis standard , 16595-80-5
Synonym(s):
(−)-Tetramisole hydrochloride;(S)-(−)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole hydrochloride;L (−)-2,3,5,6-Tetrahydro-6-phenylimidazo[2,1-b]thiazole hydrochloride;Levamisole hydrochloride
CAS NO.:16595-80-5
Empirical Formula: C11H13ClN2S
Molecular Weight: 240.75
MDL number: MFCD00012675
EINECS: 240-654-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB350.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 266-267 °C(lit.) |
| alpha | -128 º (c=5, H2O) |
| refractive index | -126 ° (C=1, H2O) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, soluble in ethanol (96 per cent), slightly soluble in methylene chloride. |
| form | Crystalline Powder |
| color | White to almost white |
| biological source | synthetic (organic) |
| optical activity | Consistent with structure |
| Water Solubility | 210 g/L (20 ºC) |
| Merck | 14,5459 |
| BRN | 4358988 |
| BCS Class | 3/1 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1/C11H12N2S.ClH/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10;/h1-5,10H,6-8H2;1H/t10-;/s3 |
| InChIKey | LAZPBGZRMVRFKY-HNCPQSOCSA-N |
| SMILES | [C@H]1(N=C2SCCN2C1)C1=CC=CC=C1.Cl |&1:0,r| |
| LogP | 1.845 (est) |
| CAS DataBase Reference | 16595-80-5(CAS DataBase Reference) |
| EPA Substance Registry System | Levamisole hydrochloride (16595-80-5) |
Description and Uses
Levamisole hydrochloride is an anthelmintic. The activity of levamisole is about twice as high as that of abscisicidal, and the toxicity and side effects are lower. Levamisole can cause muscle paralysis of roundworms and then excrete them in the feces. It is mainly used as an anti-worm and anti-hookworm.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn,F |
| Risk Statements | 25-20/21/22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36/37/39-45-28A-36-36/37-16 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NJ5960000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |



![(S)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole](https://img.chemicalbook.com/CAS/GIF/14769-73-4.gif)


![6-phenyl-2,3-dihydroimidazo[2,1-b]thiazole](https://img.chemicalbook.com/CAS/GIF/4335-28-8.gif)
