A5272712
Lasalocid A sodium salt solution , 100ng/uLinacetonitrile,analyticalstandard , 25999-20-6
CAS NO.:25999-20-6
Empirical Formula: C34H53NaO8
Molecular Weight: 612.77
MDL number: MFCD00078065
EINECS: 247-400-3
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180 °C (dec.)(lit.) |
| Flash point: | 6 °C |
| storage temp. | 0-6°C |
| solubility | DMSO:100.0(Max Conc. mg/mL);163.19(Max Conc. mM) |
| form | Solid |
| color | Off-White to Light Beige |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | RDHDUYAKDYQPEW-PIRNNYMFNA-M |
| SMILES | [Na+].CC[C@H]([C@H]1O[C@@](CC)(C[C@@H]1C)[C@H]2CC[C@](O)(CC)[C@H](C)O2)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCc3ccc(C)c(O)c3C([O-])=O |
Description and Uses
Coccidiostat (for poultry).
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xn,F |
| Risk Statements | 25-36-20/21/22-11 |
| Safety Statements | 28-45-36/37-16 |
| RIDADR | 2811 |
| WGK Germany | WGK 2 |
| RTECS | GP4180000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |





