A5275412
Boc-D-Lys-OH , 98% , 106719-44-2
Synonym(s):
Nα-(tert-Butoxycarbonyl)-D -lysine;Nα-Boc-D-lysine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB89.60 | In Stock |
|
| 5G | RMB296.00 | In Stock |
|
| 25G | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198 °C |
| Boiling point: | 410.5±40.0 °C(Predicted) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| refractive index | -22 ° (C=2, MeOH) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.92±0.21(Predicted) |
| color | White to Almost white |
| optical activity | [α]22/D -24°, c = 0.5% in methanol |
| Major Application | peptide synthesis |
| InChI | 1S/C11H22N2O4/c1-11(2,3)17-10(16)13-8(9(14)15)6-4-5-7-12/h8H,4-7,12H2,1-3H3,(H,13,16)(H,14,15)/t8-/m1/s1 |
| InChIKey | DQUHYEDEGRNAFO-MRVPVSSYSA-N |
| SMILES | OC([C@H](NC(OC(C)(C)C)=O)CCCCN)=O |
Description and Uses
Nα-Boc-D-lysine is an N-Boc-protected form of D-Lysine (L468930). D-Lysine is the unnatural isomer of L-Lysine (L468895) that has the ability to reduce non-enzymatic glycation in vitro. D-Lysine also exists as polypeptide chains of poly-D-lysine, a nonspecific adhesion-promoting molecule that has the potential to be a polymeric drug carrier.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 4-7-28-35-44 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |






