A5276712
L-Leucine-p-nitroanilide(Leu-pNA) , 98%, brilliant aminosine peptidase substrate , 4178-93-2
Synonym(s):
L -Leucine-4-nitroanilide
CAS NO.:4178-93-2
Empirical Formula: C12H17N3O3
Molecular Weight: 251.28
MDL number: MFCD00063681
EINECS: 224-047-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB192.00 | In Stock |
|
| 5G | RMB740.00 | In Stock |
|
| 25G | RMB3668.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90 °C |
| Boiling point: | 394.44°C (rough estimate) |
| Density | 1.1711 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO (>100 mM), and methanol (>25 mM). |
| form | Light yellow powder. |
| Appearance | Light yellow to yellow Solid |
| BRN | 2218433 |
| InChI | 1S/C12H17N3O3/c1-8(2)7-11(13)12(16)14-9-3-5-10(6-4-9)15(17)18/h3-6,8,11H,7,13H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | AXZJHDNQDSVIDR-NSHDSACASA-N |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 4178-93-2(CAS DataBase Reference) |
| EPA Substance Registry System | Pentanamide, 2-amino-4-methyl-N-(4-nitrophenyl)-, (2S)- (4178-93-2) |
Description and Uses
Substrate for the colorimetric determination of leucine aminopeptidase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |






