A5276912
L-Lysine dihydrochloride , 98% , 657-26-1
Synonym(s):
(S) -2,6-Diaminohexanoic acid dihydrochloride
CAS NO.:657-26-1
Empirical Formula: C6H16Cl2N2O2
Molecular Weight: 219.11
MDL number: MFCD00066389
EINECS: 211-518-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB69.60 | In Stock |
|
| 100G | RMB224.80 | In Stock |
|
| 500g | RMB452.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-206 °C(lit.) |
| alpha | 14 º (c=2, water 18 ºC) |
| refractive index | 15 ° (C=2, H2O) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystalline Powder |
| color | White to very light yellow |
| Water Solubility | Soluble in water (100 mg/ml). |
| Sensitive | Hygroscopic |
| Merck | 14,5636 |
| BRN | 4539715 |
| InChI | InChI=1/C6H14N2O2.2ClH/c7-4-2-1-3-5(8)6(9)10;;/h5H,1-4,7-8H2,(H,9,10);2*1H/t5-;;/s3 |
| InChIKey | JBBURJFZIMRPCZ-WHWWGIJDNA-N |
| SMILES | [C@@H](N)(C(=O)O)CCCCN.Cl.Cl |&1:0,r| |
| CAS DataBase Reference | 657-26-1(CAS DataBase Reference) |
| EPA Substance Registry System | Lysine dihydrochloride (657-26-1) |
| CAS Number Unlabeled | 657-26-1 |
Description and Uses
Synthesis of hyperbranched polylysine using the N-hydroxysuccinimide ester of L-lysine dihydrochloride as AB 2 building block. The histidine and lysine standards were prepared from L-histidine monohydro- chloride and L-lysine dihydrochloride respectively. L-Homocitrulline-The copper complex was prepared from L-lysine dihydrochloride in 80 to 86 per cent yields.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29224190 |
| Storage Class | 11 - Combustible Solids |





