A5287312
5-Iodotubercidin , ≥98% , 24386-93-4
Synonym(s):
4-Amino-5-iodo-7-(β-D -ribofuranosyl)pyrrolo[2,3-d]pyrimidine;5-Iodotubericidin;7-Iodo-7-deazaadenosine
CAS NO.:24386-93-4
Empirical Formula: C11H13IN4O4
Molecular Weight: 392.15
MDL number: MFCD00055131
EINECS: 200-001-2
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB23.20 | In Stock |
|
| 25MG | RMB55.20 | In Stock |
|
| 250mg | RMB440.00 | In Stock |
|
| 1g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-217°C dec. |
| Boiling point: | 701.5±60.0 °C(Predicted) |
| Density | 2.49±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | 0.1 M HCl: 0.7 mg/mL |
| form | solid |
| pka | 12.33±0.70(Predicted) |
| color | tan |
| Stability: | Store tightly sealed at 4°C; Light Sensitive |
| InChI | InChI=1/C11H13IN4O4/c12-4-1-16(10-6(4)9(13)14-3-15-10)11-8(19)7(18)5(2-17)20-11/h1,3,5,7-8,11,17-19H,2H2,(H2,13,14,15)/t5-,7-,8-,11-/s3 |
| InChIKey | WHSIXKUPQCKWBY-IOSLPCCCSA-N |
| SMILES | N1(C=C(I)C2C(N)=NC=NC1=2)[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 |&1:11,12,14,16,r| |
| CAS DataBase Reference | 24386-93-4 |
Description and Uses
A potent and competitive inhibitor of ERK2, PKA, and ADK.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





