A5290612
Linifanib (ABT-869) , ≥99% , 796967-16-3
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB506.88 | In Stock |
|
| 10MG | RMB639.20 | In Stock |
|
| 50MG | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-183°C (dec.) |
| Boiling point: | 542.2±50.0 °C(Predicted) |
| Density | 1.424 |
| storage temp. | -20°C Freezer |
| solubility | DMSO, Methanol |
| pka | 13.30±0.70(Predicted) |
| form | Brown powder. |
| color | Beige |
| InChI | InChI=1S/C21H18FN5O/c1-12-5-10-16(22)18(11-12)25-21(28)24-14-8-6-13(7-9-14)15-3-2-4-17-19(15)20(23)27-26-17/h2-11H,1H3,(H3,23,26,27)(H2,24,25,28) |
| InChIKey | MPVGZUGXCQEXTM-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(C2=CC=CC3=C2C(N)=NN3)C=C1)C(NC1=CC(C)=CC=C1F)=O |
Description and Uses
Linifanib (ABT 869) is an oral tyrosine kinase inhibitor with antineoplasic activity. As a dual inhibitor, Linifanib, is being tested on several different cancers.
Safety
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H410-H372-H361-H400 |
| Precautionary statements | P273-P391-P501-P273-P391-P501-P260-P264-P270-P314-P501-P201-P202-P281-P308+P313-P405-P501 |
| HS Code | 2933998090 |
