A2438112
Clomiphene citrate salt , 98%, a mixture , 50-41-9
Synonym(s):
2-(4-[2-Chloro-1,2-diphenylethenyl]phenoxy)-N,N-diethylethanamine;Clomiphene citrate salt
CAS NO.:50-41-9
Empirical Formula: C32H36ClNO8
Molecular Weight: 598.08
MDL number: MFCD00058322
EINECS: 200-035-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB280.00 | In Stock |
|
| 10G | RMB1192.00 | In Stock |
|
| 25g | RMB3225.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116.5-118°C |
| storage temp. | 2-8°C |
| solubility | Slightly soluble in water, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Slightly soluble in water, methanol, chloroform (slightly), and DMSO (10 mM). Insoluble in ether. |
| BCS Class | 3/1 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | PYTMYKVIJXPNBD-OQKDUQJOSA-N |
| SMILES | N(CC)(CC)CCOC1=CC=C(/C(/C2=CC=CC=C2)=C(\Cl)/C2=CC=CC=C2)C=C1.C(O)(=O)CC(CC(O)=O)(C(O)=O)O |
| CAS DataBase Reference | 50-41-9(CAS DataBase Reference) |
| IARC | 3 (Vol. 21, Sup 7) 1987 |
| EPA Substance Registry System | Clomiphene citrate (50-41-9) |
Description and Uses
Clomiphene is a selective estrogen receptor modulator that impairs the activation of estrogen receptors (ERs) by 17β-estradiol. It potently binds both ERα and ERβ (Ki = 0.9 and 1.2 nM, respectively). Clomiphene enhances the release of gonadotropin-releasing hormone, stimulating the release of follicle-stimulating hormone and luteinizing hormone, culminating in ovulation.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 60-63 |
| Safety Statements | 53-36/37-45 |
| WGK Germany | 3 |
| RTECS | YE0875000 |
| HazardClass | IRRITANT |
| HS Code | 2922190900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
| Toxicity | LD50 oral in rat: 5750mg/kg |






