A5293312
Loratadine , ≥98% , 79794-75-5
Synonym(s):
4-(8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene-1-piperidinecarboxylic acid ethyl ester;Loratadine;Loratidine
CAS NO.:79794-75-5
Empirical Formula: C22H23ClN2O2
Molecular Weight: 382.88
MDL number: MFCD00672869
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB23.20 | In Stock |
|
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 500mg | RMB86.40 | In Stock |
|
| 25g | RMB159.20 | In Stock |
|
| 100g | RMB600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-136°C |
| Boiling point: | 531.3±50.0 °C(Predicted) |
| Density | 1.261±0.06 g/cm3(Predicted) |
| RTECS | TM6129200 |
| storage temp. | 2-8°C |
| solubility | DMSO: 26 mg/mL, soluble |
| form | powder |
| pka | 4.27±0.20(Predicted) |
| color | white |
| Water Solubility | It is soluble in DMSO (50 mg/ml), ethanol (77 mg/ml at 25°C), water (<1 mg/ml at 25°C), chloroform, and methanol. |
| Merck | 14,5578 |
| BCS Class | 2 |
| Stability: | Stable, but may be heat sensitive - refrigerate. Incompatible with strong oxidizing agents. |
| InChI | 1S/C22H23ClN2O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3 |
| InChIKey | JCCNYMKQOSZNPW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CC\C(CC1)=C2/c3ccc(Cl)cc3CCc4cccnc24 |
| CAS DataBase Reference | 79794-75-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Piperidinecarboxylic acid, 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-, ethyl ester (79794-75-5) |
Description and Uses
Loratadine is a non-sedating antihistamine indicated for use in allergic rhinitis and chronic urticaria. Its major advantage over other non-sedating antihistamines such as astemizole and terfenadine is its very fast onset of action. Loratadine is claimed not to cross the blood-brain barrier.
Histamine H1 receptor antagonist; antihistamine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 79794-75-5(Hazardous Substances Data) |





![8-Chloro-11-(1-methylpiperidin-4-yl)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ol](https://img.chemicalbook.com/CAS/GIF/38089-93-9.gif)
![4,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-β]pyridin-11-one (Loratadine Impurity)](https://img.chemicalbook.com/CAS/GIF/133330-60-6.gif)
