A2967112
8-Chloroazatadine , 95% , 38092-89-6
Synonym(s):
N-Methyldesloratadine;8-Chloro-6,11-dihydro-11-(1-methyl-4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridine
CAS NO.:38092-89-6
Empirical Formula: C20H21ClN2
Molecular Weight: 324.85
MDL number: MFCD06411084
EINECS: 641-012-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB66.40 | In Stock |
|
| 250MG | RMB162.40 | In Stock |
|
| 25g | RMB237.60 | In Stock |
|
| 1G | RMB405.60 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-109°C |
| Boiling point: | 474.3±45.0 °C(Predicted) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.67±0.20(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C20H21ClN2/c1-23-11-8-14(9-12-23)19-18-7-6-17(21)13-16(18)5-4-15-3-2-10-22-20(15)19/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3 |
| InChIKey | VLXSCTINYKDTKR-UHFFFAOYSA-N |
| SMILES | C12/C(=C3\CCN(C)CC\3)/C3=CC=C(Cl)C=C3CCC1=CC=CN=2 |
| CAS DataBase Reference | 38092-89-6(CAS DataBase Reference) |
Description and Uses
An intermediate in the synthesis of Loratadine. Loratadine impurity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| WGK Germany | WGK 3 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |







![8-Chloro-11-(1-methylpiperidin-4-yl)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ol](https://img.chemicalbook.com/CAS/GIF/38089-93-9.gif)