A5303312
L-Homocysteine , ≥95.0% , 6027-13-0
Synonym(s):
(S)-2-Amino-4-mercaptobutyric acid
CAS NO.:6027-13-0
Empirical Formula: C4H9NO2S
Molecular Weight: 135.18
MDL number: MFCD00151320
EINECS: 227-891-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB239.20 | In Stock |
|
| 50MG | RMB479.20 | In Stock |
|
| 250MG | RMB1264.00 | In Stock |
|
| 1g | RMB2679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232°C |
| Boiling point: | 299.7±35.0 °C(Predicted) |
| Density | 1.149 (estimate) |
| refractive index | 1.5480 (estimate) |
| storage temp. | -20°C |
| solubility | Aqueous Acid (Sparingly, Heated, Sonicated), Water (Slightly, Heated) |
| form | solid |
| pka | 2.24±0.10(Predicted) |
| color | White to Off-White |
| optical activity | [α]/D 25.5±1.5°, c = 1 in 1 M HCl |
| Stability: | Air Sensitive, Hygroscopic |
| Major Application | cell analysis |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-N |
| SMILES | C(O)(=O)[C@H](CCS)N |
| CAS DataBase Reference | 6027-13-0(CAS DataBase Reference) |
Description and Uses
L-Homocysteine is the hydrolysis product of adenosine (A280400), a purine nucleoside. Metabolic fate of L-Homocysteine is converted back to L-Methionine( M260440) via tetrahydrofolate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H413-H372 |
| Precautionary statements | P501-P273-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Toxicity | mouse,LD50,intraperitoneal,> 1082mg/kg (1082mg/kg),Yakugaku Zasshi. Journal of Pharmacy. Vol. 94, Pg. 1419, 1974. |






