A5304112
(2S)-N-2-Naphthalenyl-5-Oxo-2-Pyrrolidinecarboxamide , ≥98% , 22155-91-5
Synonym(s):
L -Pyroglutamic acid β-naphthylamide;L -Pyrrolidonyl-β-naphthylamide;N1-(2-Naphthyl)-L -pyroglutamic acid;PYR
CAS NO.：22155-91-5
Empirical Formula: C15H14N2O2
Molecular Weight: 254.28
MDL number: MFCD00055911
EINECS: 244-809-9
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB207.20 | In Stock |
|
| 100MG | RMB399.20 | In Stock |
|
| 500MG | RMB1394.40 | In Stock |
|
| 1G | RMB2359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-193°C |
| Boiling point: | 616.9±48.0 °C(Predicted) |
| Density | 1.311±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: 50 mg/mL, clear, colorless |
| form | powder |
| pka | 13.51±0.20(Predicted) |
| color | White |
| BRN | 5066652 |
| InChI | 1S/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18)/t13-/m0/s1 |
| InChIKey | BZEPQNMASTUAMY-ZDUSSCGKSA-N |
| SMILES | O=C1CC[C@H](N1)C(=O)Nc2ccc3ccccc3c2 |
| CAS DataBase Reference | 22155-91-5(CAS DataBase Reference) |
Description and Uses
L-PYROGLUTAMIC ACID BETA-NAPHTHYLAMIDE is a substrate for pyroglutamate aminopeptidase. Used for colorimetric determination of pyrrolidonyl peptidase activity in bacteria
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H400 |
| Precautionary statements | P273 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-50/53 |
| Safety Statements | 22-24/25-61-60 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933790090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 |
