A5305812
L-Cystathionine , ≥98% , 56-88-2
Synonym(s):
(R)-S-(2-Amino-2-carboxyethyl)-L -homocysteine
CAS NO.:56-88-2
Empirical Formula: C7H14N2O4S
Molecular Weight: 222.26
MDL number: MFCD00036685
EINECS: 200-295-8
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB727.20 | In Stock |
|
| 50mg | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 312 |
| alpha | D20 +23.7° (1N HCl) |
| Density | 1.430±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| solubility | Aqueous Acid (Slightly) |
| form | Solid |
| Boiling point: | 481.0±45.0 °C(Predicted) |
| pka | 2.08±0.10(Predicted) |
| color | White to Off-White |
| optical activity | +26.425 (1 mol dm-3 HCl) |
| Merck | 13,2807 |
| BRN | 2505200 |
| InChI | 1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | ILRYLPWNYFXEMH-WHFBIAKZSA-N |
| SMILES | N[C@@H](CCSC[C@H](N)C(O)=O)C(O)=O |
Description and Uses
L-
Intermediate in transsulfuration whereby the mammal transfers the sulfur of methionine via homocysteine to cysteine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |



