A5310012
Lauramide , >96.0%(GC) , 1120-16-7
CAS NO.：1120-16-7
Empirical Formula: C12H25NO
Molecular Weight: 199.33
MDL number: MFCD00025532
EINECS: 214-298-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB127.20 | In Stock |
|
| 25G | RMB447.20 | In Stock |
|
| 100G | RMB1279.20 | In Stock |
|
| 500G | RMB3592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99°C |
| Boiling point: | 200 °C / 12mmHg |
| Density | 0.9216 (rough estimate) |
| refractive index | 1.4287 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 16.62±0.40(Predicted) |
| color | White to Almost white |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | VISCOSITY CONTROLLING |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H2,13,14) |
| InChIKey | ILRSCQWREDREME-UHFFFAOYSA-N |
| SMILES | C(N)(=O)CCCCCCCCCCC |
| LogP | 4.235 (est) |
| CAS DataBase Reference | 1120-16-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Dodecanamide(1120-16-7) |
| EPA Substance Registry System | Dodecanamide (1120-16-7) |
