A5347012
Morpho CDI , 95% , 2491-17-0
Synonym(s):
N-Cyclohexyl-N′-(β-[N-methylmorpholino]ethyl)carbodiimide p-toluenesulfonate salt;4-[2-[(Cyclohexylcarbonimidoyl)amino]ethyl]-4-methylmorpholinium p-toluenesulfonate;CMC;CMC metho-p-toluenesulfonate;Morpho CDI
CAS NO.:2491-17-0
Empirical Formula: C21H33N3O4S
Molecular Weight: 423.57
MDL number: MFCD00011979
EINECS: 219-650-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB149.60 | In Stock |
|
| 5G | RMB577.60 | In Stock |
|
| 25G | RMB2108.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-120 °C |
| Density | 1.1302 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Water Solubility | Soluble in water |
| solubility | sol DMF, MeCN |
| form | Powder |
| color | White to slightly yellow |
| InChI | InChI=1S/C14H26N3O.C7H8O3S/c1-17(9-11-18-12-10-17)8-7-15-13-16-14-5-3-2-4-6-14;1-6-2-4-7(5-3-6)11(8,9)10/h14H,2-12H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | GBCAVSYHPPARHX-UHFFFAOYSA-M |
| SMILES | [N+]1(C)(CCN=C=NC2CCCCC2)CCOCC1.C1(S([O-])(=O)=O)=CC=C(C)C=C1 |
| EPA Substance Registry System | Morpholinium, 4-[2-[(cyclohexylcarbonimidoyl)amino]ethyl]-4-methyl-, salt with 4-methylbenzenesulfonic acid (1:1) (2491-17-0) |
Description and Uses
Employed in a facile sequencing technique for pseudouridylate residues in RNA.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |



![3-Hexyl-1,2-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide](https://img.chemicalbook.com/CAS/20180808/GIF/384347-22-2.gif)


