A5350712
Methyl (R)-(+)-2-(4-hydroxyphenoxy)propionate , 97% , 96562-58-2
CAS NO.：96562-58-2
Empirical Formula: C10H12O4
Molecular Weight: 196.2
MDL number: MFCD00274087
EINECS: 411-950-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB186.40 | In Stock |
|
| 100G | RMB587.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-67 °C (lit.) |
| Boiling point: | 313.4±17.0 °C(Predicted) |
| Density | 1.187±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 42.5 ° (C=1, CHCl3) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 9320 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| pka | 10.07±0.15(Predicted) |
| color | White to Orange to Green |
| optical activity | [α]22/D +43°, c = 1 in chloroform |
| Water Solubility | 13.46g/L at 20℃ |
| InChI | 1S/C10H12O4/c1-7(10(12)13-2)14-9-5-3-8(11)4-6-9/h3-7,11H,1-2H3/t7-/m1/s1 |
| InChIKey | UUYSCNGPNOYZMC-SSDOTTSWSA-N |
| SMILES | COC(=O)[C@@H](C)Oc1ccc(O)cc1 |
| LogP | 1.29 at 22℃ |
| CAS DataBase Reference | 96562-58-2(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 2-(4-hydroxyphenoxy)-, methyl ester, (2R)- (96562-58-2) |
Description and Uses
Methyl 2-(4-Hydroxyphenoxy)propionate is an intermediate in the synthesis of (±)-Fluazifop (F407430), a grass-selective herbicide which inhibits acetyl-CoA carboxylase in sensitive plant species.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318-H412 |
| Precautionary statements | P273-P280-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 41-52/53 |
| Safety Statements | 26-39-61 |
| WGK Germany | 2 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 |
