PRODUCT Properties
| Melting point: | 144-147 °C (lit.) |
| Boiling point: | 322.7±25.0 °C(Predicted) |
| Density | 1.345±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Ether,Alcohol |
| form | powder to crystal |
| pka | 3.95±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Stability: | Sensitive to Oxidation in Air |
| InChI | InChI=1S/C7H6O2S/c8-7(9)5-2-1-3-6(10)4-5/h1-4,10H,(H,8,9) |
| InChIKey | RSFDFESMVAIVKO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(S)=C1 |
| CAS DataBase Reference | 4869-59-4(CAS DataBase Reference) |
Description and Uses
An aromatic thiol compound reducing agent hair cosmetic
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41-36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29309090 |
