A5355012
4′-(Methylthio)acetophenone , 97% , 1778-09-2
CAS NO.：1778-09-2
Empirical Formula: C9H10OS
Molecular Weight: 166.24
MDL number: MFCD00039835
EINECS: 217-213-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB758.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82 °C(lit.) |
| Boiling point: | 135 °C |
| Density | 1.1369 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| Flash point: | 135°C/1mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| color | White to Off-White |
| BRN | 1860517 |
| InChI | InChI=1S/C9H10OS/c1-7(10)8-3-5-9(11-2)6-4-8/h3-6H,1-2H3 |
| InChIKey | JECUZQLBQKNEMW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(SC)C=C1)C |
| CAS DataBase Reference | 1778-09-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-CH3S-C6H4-COCH3(1778-09-2) |
| EPA Substance Registry System | 4'-(Methylmercapto)acetophenone (1778-09-2) |
Description and Uses
4′-(Methylthio)acetophenone may be used for the synthesis of Vioxx (Rofecoxib), an non-steroidal anti-inflammatory drug (NSAID). It may be used in the synthesis of (E)-1-[4-(methylsulfanyl)phenyl]-3-phenylprop-2-en-1-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29309099 |
