A5356112
Methyl 5-Norbornene-2-carboxylate(endo- and exo- mixture) , 96% , 6203-08-3
Synonym(s):
5-Norbornene-2-carboxylic acid methyl ester;Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid methyl ester
| Pack Size | Price | Stock | Quantity |
| 5G | RMB165.60 | In Stock |
|
| 25G | RMB594.40 | In Stock |
|
| 100g | RMB1431.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 70-71 °C(Press: 12 Torr) |
| Density | 1.06 |
| refractive index | 1.4720 to 1.4770 |
| Flash point: | 68°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C9H12O2/c1-11-9(10)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | RMAZRAQKPTXZNL-UHFFFAOYSA-N |
| SMILES | C12CC(C=C1)CC2C(OC)=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2917200090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |






![2-Ethoxyethylbicyclo[2.2.1]hept-5-ene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/46399-60-4.gif)
